What is structural formula of aspirin?
C₉H₈O₄
Aspirin/Formula
Which of the following is the correct structural formula of aspirin?
Aspirin
| Clinical data | |
|---|---|
| Chemical and physical data | |
| Formula | C9H8O4 |
| Molar mass | 180.159 g/mol |
| 3D model (JSmol) | Interactive image |
What is the structural relation between salicylic acid and aspirin?
Aspirin belongs to a family of compounds called the salicylates, the simplest of which is salicylic acid. Salicylic acid is the principal metabolite of aspirin, aspirin having a half‐life of <30 min. Many of the salicylates share the same properties as aspirin, although its anti‐platelet action is specific.
What is the Iupac name and structure of aspirin?
Aspirin: Summary in Tabular Form
| Aspirin | |
|---|---|
| Chemical formula | CH3COOC6H4COOH or C9H8O4 |
| IUPAC Name | 2-acetoxybenzoic acid |
| Other names | Acetylsalicylic acid, aspirin, acetylsalicylate. |
| Molar mass | 180.16 g/mol |
How is aspirin made today?
Aspirin is prepared by chemical synthesis from salicylic acid, through acetylation with acetic anhydride. The molecular weight of aspirin is 180.16g/mol. It is odourless, colourless to white crystals or crystalline powder.
Is aspirin an acid or base?
Aspirin itself is an acidic medicine and causes gastric irritation and regurgitation which can lead to low oral pH levels [7].
Which of the following structures is aspirin?
Since the IUPAC name of aspirin is 2-acetoxybenzoic acid, let us first see its structure. From the structure of aspirin, we can see that it is an acetyl derivative of salicylic acid. It is formed when salicylic acid (2-hydroxybenzoic acid) is treated with acetic anhydride.
Is aspirin a antibiotic?
Therefore, Aspirin is an antipyretic. It is not an antibiotic as it doesn’t kill any micro-organisms, like bacteria neither is it an antiseptic.
What acid is found in aspirin?
The Chemistry of Aspirin (acetylsalicylic acid) Aspirin is prepared by chemical synthesis from salicylic acid, through acetylation with acetic anhydride. The molecular weight of aspirin is 180.16g/mol.
What is aspirin bad for?
Although aspirin can prevent clotting and, therefore, prevent strokes and heart attacks, it can also result in dangerous bleeding and other side effects, Cutler adds. In addition to bleeding in the gastrointestinal tract, daily aspirin therapy can increase the risk of a bleeding stroke.
Why is aspirin so important?
Aspirin has been shown to be helpful when used daily to lower the risk of heart attack, clot-related strokes and other blood flow problems in patients who have cardiovascular disease or who have already had a heart attack or stroke. Many medical professionals prescribe aspirin for these uses.
Is yogurt acidic or basic?
Yogurt and buttermilk are alkaline-forming foods despite having low pH levels between 4.4 and 4.8. The American College of Healthcare Sciences notes that raw milk is also an exception; it may be alkaline-forming.
What is the chemical and structural formula of aspirin?
The structural formula of aspirin or Acetylsalicylic acid is represented as- Aspirin is extensively used in the pharmaceutical sector. The most common way to prepare aspirin is by using Acid Anhydrides and by reacting acetic acid with salicylic acid.
How does aspirin and citric acid work together?
It neutralizes stomach acid by combining with it to form a new substance that is not an acid. Aspirin, sodium bicarbonate, and citric acid combination may also be used to lessen the chance of heart attack, stroke, or other problems that may occur when a blood vessel is blocked by blood clots.
What is the chemical formula for citric acid?
Citric acid PubChem CID 311 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C6H8O7 or CH2COOH-C(OH)COOH-CH2COOH Synonyms citric acid 77-92-9
Why is the molecular geometry of aspirin planar?
Coming to the molecular geometry of Aspirin, it is planar. It is so due to the phenyl ring and carboxylic groups having sp2 hybridization. In the common representations which we use for organic molecules, the chemical structure of Aspirin is written as below: Much like other compounds, Acetylsalicylic Acid also does not occur naturally in nature.
